C21H36N2 — CID 155483682
(5E,8E)-6-(2-butan-2-yl-4-methylideneazetidin-1-yl)-N,5-dimethylundeca-5,8-dien-2-imine (PubChem CID 155483682) has the molecular formula C21H36N2 and a molecular weight of 316.53 g/mol. Its IUPAC name is (5E,8E)-6-(2-butan-2-yl-4-methylideneazetidin-1-yl)-N,5-dimethylundeca-5,8-dien-2-imine.
| Compound Name | (5E,8E)-6-(2-butan-2-yl-4-methylideneazetidin-1-yl)-N,5-dimethylundeca-5,8-dien-2-imine |
|---|---|
| PubChem CID | 155483682 |
| Molecular Formula | C21H36N2 |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.29 |
| IUPAC Name | (5E,8E)-6-(2-butan-2-yl-4-methylideneazetidin-1-yl)-N,5-dimethylundeca-5,8-dien-2-imine |
| SMILES | C=C1CC(C(C)CC)N1/C(C/C=C/CC)=C(\C)CC/C(C)=N/C |
| InChI | InChI=1S/C21H36N2/c1-8-10-11-12-20(17(4)13-14-18(5)22-7)23-19(6)15-21(23)16(3)9-2/h10-11,16,21H,6,8-9,12-15H2,1-5,7H3/b11-10+,20-17+,22-18+ |
| InChIKey | WIGFOPXIMMUHFY-HAMUXMDPSA-N |
| XLogP | 6.12 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|