C30H24BrN — CID 155483685
N-(5-bromocyclohexa-1,3-dien-1-yl)-4-phenyl-N-(4-phenylphenyl)aniline (PubChem CID 155483685) has the molecular formula C30H24BrN and a molecular weight of 478.43 g/mol. Its IUPAC name is N-(5-bromocyclohexa-1,3-dien-1-yl)-4-phenyl-N-(4-phenylphenyl)aniline.
| Compound Name | N-(5-bromocyclohexa-1,3-dien-1-yl)-4-phenyl-N-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 155483685 |
| Molecular Formula | C30H24BrN |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | N-(5-bromocyclohexa-1,3-dien-1-yl)-4-phenyl-N-(4-phenylphenyl)aniline |
| SMILES | BrC1C=CC=C(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C30H24BrN/c31-27-12-7-13-30(22-27)32(28-18-14-25(15-19-28)23-8-3-1-4-9-23)29-20-16-26(17-21-29)24-10-5-2-6-11-24/h1-21,27H,22H2 |
| InChIKey | SZRONUBMUKQEOZ-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|