C20H22F6N4O3 — CID 155483703
(3R,4R)-3-methyl-4-[[[5-[3-(trifluoromethoxy)phenyl]-1-(3,3,3-trifluoropropyl)pyrazol-3-yl]amino]methoxymethyl]pyrrolidin-2-one (PubChem CID 155483703) has the molecular formula C20H22F6N4O3 and a molecular weight of 480.41 g/mol. Its IUPAC name is (3R,4R)-3-methyl-4-[[[5-[3-(trifluoromethoxy)phenyl]-1-(3,3,3-trifluoropropyl)pyrazol-3-yl]amino]methoxymethyl]pyrrolidin-2-one.
| Compound Name | (3R,4R)-3-methyl-4-[[[5-[3-(trifluoromethoxy)phenyl]-1-(3,3,3-trifluoropropyl)pyrazol-3-yl]amino]methoxymethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 155483703 |
| Molecular Formula | C20H22F6N4O3 |
| Molecular Weight | 480.41 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | (3R,4R)-3-methyl-4-[[[5-[3-(trifluoromethoxy)phenyl]-1-(3,3,3-trifluoropropyl)pyrazol-3-yl]amino]methoxymethyl]pyrrolidin-2-one |
| SMILES | C[C@H]1C(=O)NC[C@@H]1COCNc1cc(-c2cccc(OC(F)(F)F)c2)n(CCC(F)(F)F)n1 |
| InChI | InChI=1S/C20H22F6N4O3/c1-12-14(9-27-18(12)31)10-32-11-28-17-8-16(30(29-17)6-5-19(21,22)23)13-3-2-4-15(7-13)33-20(24,25)26/h2-4,7-8,12,14H,5-6,9-11H2,1H3,(H,27,31)(H,28,29)/t12-,14-/m1/s1 |
| InChIKey | BRZIRZGHHGLEQI-TZMCWYRMSA-N |
| XLogP | 4.17 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|