C26H32N6O2 — CID 155483876
4-[(8aR)-8a-ethenyl-1,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrazin-2-yl]-N-(2,8-dimethylimidazo[1,2-a]pyrazin-6-yl)-2-ethoxybenzamide (PubChem CID 155483876) has the molecular formula C26H32N6O2 and a molecular weight of 460.58 g/mol. Its IUPAC name is 4-[(8aR)-8a-ethenyl-1,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrazin-2-yl]-N-(2,8-dimethylimidazo[1,2-a]pyrazin-6-yl)-2-ethoxybenzamide.
| Compound Name | 4-[(8aR)-8a-ethenyl-1,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrazin-2-yl]-N-(2,8-dimethylimidazo[1,2-a]pyrazin-6-yl)-2-ethoxybenzamide |
|---|---|
| PubChem CID | 155483876 |
| Molecular Formula | C26H32N6O2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | 4-[(8aR)-8a-ethenyl-1,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrazin-2-yl]-N-(2,8-dimethylimidazo[1,2-a]pyrazin-6-yl)-2-ethoxybenzamide |
| SMILES | C=C[C@@]12CCCN1CCN(c1ccc(C(=O)Nc3cn4cc(C)nc4c(C)n3)c(OCC)c1)C2 |
| InChI | InChI=1S/C26H32N6O2/c1-5-26-10-7-11-32(26)13-12-30(17-26)20-8-9-21(22(14-20)34-6-2)25(33)29-23-16-31-15-18(3)27-24(31)19(4)28-23/h5,8-9,14-16H,1,6-7,10-13,17H2,2-4H3,(H,29,33)/t26-/m0/s1 |
| InChIKey | BUELEILIZLJASY-SANMLTNESA-N |
| XLogP | 3.84 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|