About 2-[1,3-dioxo-4-[2-(2-propoxyethoxy)ethylamino]isoindol-2-yl]-N-methyl-5-oxopentanamide
2-[1,3-dioxo-4-[2-(2-propoxyethoxy)ethylamino]isoindol-2-yl]-N-methyl-5-oxopentanamide (PubChem CID 155484544) has the molecular formula C21H29N3O6
and a molecular weight of 419.48 g/mol. Its IUPAC name is 2-[1,3-dioxo-4-[2-(2-propoxyethoxy)ethylamino]isoindol-2-yl]-N-methyl-5-oxopentanamide.
Molecular Properties
| Compound Name | 2-[1,3-dioxo-4-[2-(2-propoxyethoxy)ethylamino]isoindol-2-yl]-N-methyl-5-oxopentanamide |
| PubChem CID | 155484544 |
| Molecular Formula | C21H29N3O6 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 2-[1,3-dioxo-4-[2-(2-propoxyethoxy)ethylamino]isoindol-2-yl]-N-methyl-5-oxopentanamide |
| SMILES | CCCOCCOCCNc1cccc2c1C(=O)N(C(CCC=O)C(=O)NC)C2=O |
| InChI | InChI=1S/C21H29N3O6/c1-3-11-29-13-14-30-12-9-23-16-7-4-6-15-18(16)21(28)24(20(15)27)17(8-5-10-25)19(26)22-2/h4,6-7,10,17,23H,3,5,8-9,11-14H2,1-2H3,(H,22,26) |
| InChIKey | ULYDZVRPMIDTJT-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[1,3-dioxo-4-[2-(2-propoxyethoxy)ethylamino]isoindol-2-yl]-N-methyl-5-oxopentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1,3-dioxo-4-[2-(2-propoxyethoxy)ethylamino]isoindol-2-yl]-N-methyl-5-oxopentanamide?
The IUPAC name of 2-[1,3-dioxo-4-[2-(2-propoxyethoxy)ethylamino]isoindol-2-yl]-N-methyl-5-oxopentanamide (CID 155484544) is 2-[1,3-dioxo-4-[2-(2-propoxyethoxy)ethylamino]isoindol-2-yl]-N-methyl-5-oxopentanamide.
What is the SMILES notation for 2-[1,3-dioxo-4-[2-(2-propoxyethoxy)ethylamino]isoindol-2-yl]-N-methyl-5-oxopentanamide?
The canonical SMILES for 2-[1,3-dioxo-4-[2-(2-propoxyethoxy)ethylamino]isoindol-2-yl]-N-methyl-5-oxopentanamide is CCCOCCOCCNc1cccc2c1C(=O)N(C(CCC=O)C(=O)NC)C2=O.
What is the InChIKey of 2-[1,3-dioxo-4-[2-(2-propoxyethoxy)ethylamino]isoindol-2-yl]-N-methyl-5-oxopentanamide?
The InChIKey is ULYDZVRPMIDTJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29N3O6/c1-3-11-29-13-14-30-12-9-23-16-7-4-6-15-18(16)21(28)24(20(15)27)17(8-5-10-25)19(26)22-2/h4,6-7,10,17,23H,3,5,8-9,11-14H2,1-2H3,(H,22,26).
What are the key properties of 2-[1,3-dioxo-4-[2-(2-propoxyethoxy)ethylamino]isoindol-2-yl]-N-methyl-5-oxopentanamide?
2-[1,3-dioxo-4-[2-(2-propoxyethoxy)ethylamino]isoindol-2-yl]-N-methyl-5-oxopentanamide has a molecular weight of 419.48 g/mol, XLogP of 1.23, 14 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,3-dioxo-4-[2-(2-propoxyethoxy)ethylamino]isoindol-2-yl]-N-methyl-5-oxopentanamide is sourced from PubChem (CID 155484544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).