C7H12NP — CID 155484713
(2Z,4E)-N,3-dimethyl-5-phosphanylpenta-2,4-dien-1-imine (PubChem CID 155484713) has the molecular formula C7H12NP and a molecular weight of 141.15 g/mol. Its IUPAC name is (2Z,4E)-N,3-dimethyl-5-phosphanylpenta-2,4-dien-1-imine.
| Compound Name | (2Z,4E)-N,3-dimethyl-5-phosphanylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 155484713 |
| Molecular Formula | C7H12NP |
| Molecular Weight | 141.15 g/mol |
| Exact Mass | 141.07 |
| IUPAC Name | (2Z,4E)-N,3-dimethyl-5-phosphanylpenta-2,4-dien-1-imine |
| SMILES | C/N=C/C=C(C)\C=C\P |
| InChI | InChI=1S/C7H12NP/c1-7(4-6-9)3-5-8-2/h3-6H,9H2,1-2H3/b6-4+,7-3-,8-5+ |
| InChIKey | HPSCTYIUCIXEGX-HZCKPSDASA-N |
| XLogP | 2.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.15 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|