C23H40O6 — CID 15548504
(1S,2S,3S,4R,7R,8S,9E,11R,12R,13R,14R,16S)-3,11,13-trihydroxy-2,4,7,8,10,12,14,16-octamethyl-6,17-dioxabicyclo[11.3.1]heptadec-9-en-5-one (PubChem CID 15548504) has the molecular formula C23H40O6 and a molecular weight of 412.57 g/mol. Its IUPAC name is (1S,2S,3S,4R,7R,8S,9E,11R,12R,13R,14R,16S)-3,11,13-trihydroxy-2,4,7,8,10,12,14,16-octamethyl-6,17-dioxabicyclo[11.3.1]heptadec-9-en-5-one.
| Compound Name | (1S,2S,3S,4R,7R,8S,9E,11R,12R,13R,14R,16S)-3,11,13-trihydroxy-2,4,7,8,10,12,14,16-octamethyl-6,17-dioxabicyclo[11.3.1]heptadec-9-en-5-one |
|---|---|
| PubChem CID | 15548504 |
| Molecular Formula | C23H40O6 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | (1S,2S,3S,4R,7R,8S,9E,11R,12R,13R,14R,16S)-3,11,13-trihydroxy-2,4,7,8,10,12,14,16-octamethyl-6,17-dioxabicyclo[11.3.1]heptadec-9-en-5-one |
| SMILES | C/C1=C\[C@H](C)[C@@H](C)OC(=O)[C@H](C)[C@@H](O)[C@H](C)[C@H]2O[C@](O)([C@H](C)C[C@@H]2C)[C@H](C)[C@H]1O |
| InChI | InChI=1S/C23H40O6/c1-11-9-12(2)19(24)17(7)23(27)14(4)10-13(3)21(29-23)15(5)20(25)16(6)22(26)28-18(11)8/h9,11,13-21,24-25,27H,10H2,1-8H3/b12-9+/t11-,13-,14+,15-,16+,17+,18+,19-,20-,21-,23+/m0/s1 |
| InChIKey | PDZHGKORODHUGZ-PJGWFDTMSA-N |
| XLogP | 2.89 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|