About S-(2-acetamidoethyl) (E,5R)-5-hydroxy-2-methylhex-2-enethioate
S-(2-acetamidoethyl) (E,5R)-5-hydroxy-2-methylhex-2-enethioate (PubChem CID 15548507) has the molecular formula C11H19NO3S
and a molecular weight of 245.34 g/mol. Its IUPAC name is S-(2-acetamidoethyl) (E,5R)-5-hydroxy-2-methylhex-2-enethioate.
Molecular Properties
| Compound Name | S-(2-acetamidoethyl) (E,5R)-5-hydroxy-2-methylhex-2-enethioate |
| PubChem CID | 15548507 |
| Molecular Formula | C11H19NO3S |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | S-(2-acetamidoethyl) (E,5R)-5-hydroxy-2-methylhex-2-enethioate |
| SMILES | CC(=O)NCCSC(=O)/C(C)=C/C[C@@H](C)O |
| InChI | InChI=1S/C11H19NO3S/c1-8(4-5-9(2)13)11(15)16-7-6-12-10(3)14/h4,9,13H,5-7H2,1-3H3,(H,12,14)/b8-4+/t9-/m1/s1 |
| InChIKey | NOYFJPMBDNKZBN-VGANXODHSA-N |
| XLogP | 1.10 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-acetamidoethyl) (E,5R)-5-hydroxy-2-methylhex-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-acetamidoethyl) (E,5R)-5-hydroxy-2-methylhex-2-enethioate?
The IUPAC name of S-(2-acetamidoethyl) (E,5R)-5-hydroxy-2-methylhex-2-enethioate (CID 15548507) is S-(2-acetamidoethyl) (E,5R)-5-hydroxy-2-methylhex-2-enethioate.
What is the SMILES notation for S-(2-acetamidoethyl) (E,5R)-5-hydroxy-2-methylhex-2-enethioate?
The canonical SMILES for S-(2-acetamidoethyl) (E,5R)-5-hydroxy-2-methylhex-2-enethioate is CC(=O)NCCSC(=O)/C(C)=C/C[C@@H](C)O.
What is the InChIKey of S-(2-acetamidoethyl) (E,5R)-5-hydroxy-2-methylhex-2-enethioate?
The InChIKey is NOYFJPMBDNKZBN-VGANXODHSA-N. The full InChI is InChI=1S/C11H19NO3S/c1-8(4-5-9(2)13)11(15)16-7-6-12-10(3)14/h4,9,13H,5-7H2,1-3H3,(H,12,14)/b8-4+/t9-/m1/s1.
What are the key properties of S-(2-acetamidoethyl) (E,5R)-5-hydroxy-2-methylhex-2-enethioate?
S-(2-acetamidoethyl) (E,5R)-5-hydroxy-2-methylhex-2-enethioate has a molecular weight of 245.34 g/mol, XLogP of 1.10, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-acetamidoethyl) (E,5R)-5-hydroxy-2-methylhex-2-enethioate is sourced from PubChem (CID 15548507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).