C11H22F3N — CID 155485567
(4R)-1,1,1-trifluoro-2,4-dimethylnonan-4-amine (PubChem CID 155485567) has the molecular formula C11H22F3N and a molecular weight of 225.30 g/mol. Its IUPAC name is (4R)-1,1,1-trifluoro-2,4-dimethylnonan-4-amine.
| Compound Name | (4R)-1,1,1-trifluoro-2,4-dimethylnonan-4-amine |
|---|---|
| PubChem CID | 155485567 |
| Molecular Formula | C11H22F3N |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | (4R)-1,1,1-trifluoro-2,4-dimethylnonan-4-amine |
| SMILES | CCCCC[C@@](C)(N)CC(C)C(F)(F)F |
| InChI | InChI=1S/C11H22F3N/c1-4-5-6-7-10(3,15)8-9(2)11(12,13)14/h9H,4-8,15H2,1-3H3/t9?,10-/m1/s1 |
| InChIKey | ZTBBZMAGENTGFO-QVDQXJPCSA-N |
| XLogP | 3.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|