C13H22FNO2 — CID 155485579
(2E,4Z,6Z)-4-(2-ethoxyethoxy)-5-fluoronona-2,4,6-trien-1-amine (PubChem CID 155485579) has the molecular formula C13H22FNO2 and a molecular weight of 243.32 g/mol. Its IUPAC name is (2E,4Z,6Z)-4-(2-ethoxyethoxy)-5-fluoronona-2,4,6-trien-1-amine.
| Compound Name | (2E,4Z,6Z)-4-(2-ethoxyethoxy)-5-fluoronona-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 155485579 |
| Molecular Formula | C13H22FNO2 |
| Molecular Weight | 243.32 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | (2E,4Z,6Z)-4-(2-ethoxyethoxy)-5-fluoronona-2,4,6-trien-1-amine |
| SMILES | CC/C=C\C(F)=C(/C=C/CN)OCCOCC |
| InChI | InChI=1S/C13H22FNO2/c1-3-5-7-12(14)13(8-6-9-15)17-11-10-16-4-2/h5-8H,3-4,9-11,15H2,1-2H3/b7-5-,8-6+,13-12- |
| InChIKey | QNDIJKHDUVNUCF-VJHJETSQSA-N |
| XLogP | 2.70 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|