C29H38NO4+ — CID 155486718
[(3aR,8aR,9aR)-8a-methyl-5-methylidene-2-oxo-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-3-yl]methyl-(2-hydroxy-3-naphthalen-1-yloxypropyl)-methylazanium (PubChem CID 155486718) has the molecular formula C29H38NO4+ and a molecular weight of 464.63 g/mol. Its IUPAC name is [(3aR,8aR,9aR)-8a-methyl-5-methylidene-2-oxo-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-3-yl]methyl-(2-hydroxy-3-naphthalen-1-yloxypropyl)-methylazanium.
| Compound Name | [(3aR,8aR,9aR)-8a-methyl-5-methylidene-2-oxo-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-3-yl]methyl-(2-hydroxy-3-naphthalen-1-yloxypropyl)-methylazanium |
|---|---|
| PubChem CID | 155486718 |
| Molecular Formula | C29H38NO4+ |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | [(3aR,8aR,9aR)-8a-methyl-5-methylidene-2-oxo-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-3-yl]methyl-(2-hydroxy-3-naphthalen-1-yloxypropyl)-methylazanium |
| SMILES | C=C1CCC[C@]2(C)C[C@H]3OC(=O)C(C[NH+](C)CC(O)COc4cccc5ccccc45)[C@H]3CC12 |
| InChI | InChI=1S/C29H37NO4/c1-19-8-7-13-29(2)15-27-23(14-25(19)29)24(28(32)34-27)17-30(3)16-21(31)18-33-26-12-6-10-20-9-4-5-11-22(20)26/h4-6,9-12,21,23-25,27,31H,1,7-8,13-18H2,2-3H3/p+1/t21?,23-,24?,25?,27-,29-/m1/s1 |
| InChIKey | AYWGUJVWIMXXNN-DIXUBRFISA-O |
| XLogP | 3.41 |
| TPSA | 60.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|