About indolizin-5-amine;hydrochloride
indolizin-5-amine;hydrochloride (PubChem CID 155487273) has the molecular formula C8H9ClN2
and a molecular weight of 168.63 g/mol. Its IUPAC name is indolizin-5-amine;hydrochloride.
Molecular Properties
| Compound Name | indolizin-5-amine;hydrochloride |
| PubChem CID | 155487273 |
| Molecular Formula | C8H9ClN2 |
| Molecular Weight | 168.63 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | indolizin-5-amine;hydrochloride |
| SMILES | Cl.Nc1cccc2cccn12 |
| InChI | InChI=1S/C8H8N2.ClH/c9-8-5-1-3-7-4-2-6-10(7)8;/h1-6H,9H2;1H |
| InChIKey | IAMVYNBXMRYXNK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 30.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.63 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze indolizin-5-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indolizin-5-amine;hydrochloride?
The IUPAC name of indolizin-5-amine;hydrochloride (CID 155487273) is indolizin-5-amine;hydrochloride.
What is the SMILES notation for indolizin-5-amine;hydrochloride?
The canonical SMILES for indolizin-5-amine;hydrochloride is Cl.Nc1cccc2cccn12.
What is the InChIKey of indolizin-5-amine;hydrochloride?
The InChIKey is IAMVYNBXMRYXNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2.ClH/c9-8-5-1-3-7-4-2-6-10(7)8;/h1-6H,9H2;1H.
What are the key properties of indolizin-5-amine;hydrochloride?
indolizin-5-amine;hydrochloride has a molecular weight of 168.63 g/mol, XLogP of 1.94, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for indolizin-5-amine;hydrochloride is sourced from PubChem (CID 155487273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).