C16H16O — CID 155487828
5-(4-penta-1,3-dienylphenyl)penta-2,4-dienal (PubChem CID 155487828) has the molecular formula C16H16O and a molecular weight of 224.30 g/mol. Its IUPAC name is 5-(4-penta-1,3-dienylphenyl)penta-2,4-dienal.
| Compound Name | 5-(4-penta-1,3-dienylphenyl)penta-2,4-dienal |
|---|---|
| PubChem CID | 155487828 |
| Molecular Formula | C16H16O |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 5-(4-penta-1,3-dienylphenyl)penta-2,4-dienal |
| SMILES | CC=CC=Cc1ccc(C=CC=CC=O)cc1 |
| InChI | InChI=1S/C16H16O/c1-2-3-5-8-15-10-12-16(13-11-15)9-6-4-7-14-17/h2-14H,1H3 |
| InChIKey | JQKUIWLNEUKXQX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|