C16H32NO8P — CID 155488640
[(2R)-1-acetyloxy-3-[2-aminoethoxy(hydroxy)phosphoryl]oxypropan-2-yl] nonanoate (PubChem CID 155488640) has the molecular formula C16H32NO8P and a molecular weight of 397.41 g/mol. Its IUPAC name is [(2R)-1-acetyloxy-3-[2-aminoethoxy(hydroxy)phosphoryl]oxypropan-2-yl] nonanoate.
| Compound Name | [(2R)-1-acetyloxy-3-[2-aminoethoxy(hydroxy)phosphoryl]oxypropan-2-yl] nonanoate |
|---|---|
| PubChem CID | 155488640 |
| Molecular Formula | C16H32NO8P |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | [(2R)-1-acetyloxy-3-[2-aminoethoxy(hydroxy)phosphoryl]oxypropan-2-yl] nonanoate |
| SMILES | CCCCCCCCC(=O)O[C@H](COC(C)=O)COP(=O)(O)OCCN |
| InChI | InChI=1S/C16H32NO8P/c1-3-4-5-6-7-8-9-16(19)25-15(12-22-14(2)18)13-24-26(20,21)23-11-10-17/h15H,3-13,17H2,1-2H3,(H,20,21)/t15-/m1/s1 |
| InChIKey | TZXRLXPRYRMMFW-OAHLLOKOSA-N |
| XLogP | 2.30 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|