C20H22FN5O2 — CID 155490061
1-[(4-fluoro-3-methylphenyl)methyl]-3-(8-oxa-4,5,10-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-11-yl)imidazolidin-2-one (PubChem CID 155490061) has the molecular formula C20H22FN5O2 and a molecular weight of 383.43 g/mol. Its IUPAC name is 1-[(4-fluoro-3-methylphenyl)methyl]-3-(8-oxa-4,5,10-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-11-yl)imidazolidin-2-one.
| Compound Name | 1-[(4-fluoro-3-methylphenyl)methyl]-3-(8-oxa-4,5,10-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-11-yl)imidazolidin-2-one |
|---|---|
| PubChem CID | 155490061 |
| Molecular Formula | C20H22FN5O2 |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 1-[(4-fluoro-3-methylphenyl)methyl]-3-(8-oxa-4,5,10-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-11-yl)imidazolidin-2-one |
| SMILES | Cc1cc(CN2CCN(c3ccc4c(n3)OCC3NNCC43)C2=O)ccc1F |
| InChI | InChI=1S/C20H22FN5O2/c1-12-8-13(2-4-16(12)21)10-25-6-7-26(20(25)27)18-5-3-14-15-9-22-24-17(15)11-28-19(14)23-18/h2-5,8,15,17,22,24H,6-7,9-11H2,1H3 |
| InChIKey | MTZVTRAXBXQVEK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |