About 2H-isoindol-2-ium bromide
2H-isoindol-2-ium bromide (PubChem CID 155490142) has the molecular formula C8H8BrN
and a molecular weight of 198.06 g/mol. Its IUPAC name is 2H-isoindol-2-ium bromide.
Molecular Properties
| Compound Name | 2H-isoindol-2-ium bromide |
| PubChem CID | 155490142 |
| Molecular Formula | C8H8BrN |
| Molecular Weight | 198.06 g/mol |
| Exact Mass | 196.98 |
| IUPAC Name | 2H-isoindol-2-ium bromide |
| SMILES | C1=c2ccccc2=C[NH2+]1.[Br-] |
| InChI | InChI=1S/C8H7N.BrH/c1-2-4-8-6-9-5-7(8)3-1;/h1-6,9H;1H |
| InChIKey | DCVGVWVHEPVPJT-UHFFFAOYSA-N |
| XLogP | -4.26 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.06 |
| LogP ≤ 5 | -4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2H-isoindol-2-ium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-isoindol-2-ium bromide?
The IUPAC name of 2H-isoindol-2-ium bromide (CID 155490142) is 2H-isoindol-2-ium bromide.
What is the SMILES notation for 2H-isoindol-2-ium bromide?
The canonical SMILES for 2H-isoindol-2-ium bromide is C1=c2ccccc2=C[NH2+]1.[Br-].
What is the InChIKey of 2H-isoindol-2-ium bromide?
The InChIKey is DCVGVWVHEPVPJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.BrH/c1-2-4-8-6-9-5-7(8)3-1;/h1-6,9H;1H.
What are the key properties of 2H-isoindol-2-ium bromide?
2H-isoindol-2-ium bromide has a molecular weight of 198.06 g/mol, XLogP of -4.26, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-isoindol-2-ium bromide is sourced from PubChem (CID 155490142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).