About furo[3,2-d]pyrimidin-7-ylhydrazine
furo[3,2-d]pyrimidin-7-ylhydrazine (PubChem CID 155490154) has the molecular formula C6H6N4O
and a molecular weight of 150.14 g/mol. Its IUPAC name is furo[3,2-d]pyrimidin-7-ylhydrazine.
Molecular Properties
| Compound Name | furo[3,2-d]pyrimidin-7-ylhydrazine |
| PubChem CID | 155490154 |
| Molecular Formula | C6H6N4O |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | furo[3,2-d]pyrimidin-7-ylhydrazine |
| SMILES | NNc1coc2cncnc12 |
| InChI | InChI=1S/C6H6N4O/c7-10-4-2-11-5-1-8-3-9-6(4)5/h1-3,10H,7H2 |
| InChIKey | ZOIPZQOAOXRUSP-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze furo[3,2-d]pyrimidin-7-ylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furo[3,2-d]pyrimidin-7-ylhydrazine?
The IUPAC name of furo[3,2-d]pyrimidin-7-ylhydrazine (CID 155490154) is furo[3,2-d]pyrimidin-7-ylhydrazine.
What is the SMILES notation for furo[3,2-d]pyrimidin-7-ylhydrazine?
The canonical SMILES for furo[3,2-d]pyrimidin-7-ylhydrazine is NNc1coc2cncnc12.
What is the InChIKey of furo[3,2-d]pyrimidin-7-ylhydrazine?
The InChIKey is ZOIPZQOAOXRUSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4O/c7-10-4-2-11-5-1-8-3-9-6(4)5/h1-3,10H,7H2.
What are the key properties of furo[3,2-d]pyrimidin-7-ylhydrazine?
furo[3,2-d]pyrimidin-7-ylhydrazine has a molecular weight of 150.14 g/mol, XLogP of 0.51, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for furo[3,2-d]pyrimidin-7-ylhydrazine is sourced from PubChem (CID 155490154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).