C9H4N6O — CID 155490229
11-azido-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 155490229) has the molecular formula C9H4N6O and a molecular weight of 212.17 g/mol. Its IUPAC name is 11-azido-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 11-azido-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 155490229 |
| Molecular Formula | C9H4N6O |
| Molecular Weight | 212.17 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 11-azido-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | [N-]=[N+]=Nc1ccc2c(n1)oc1cncnc12 |
| InChI | InChI=1S/C9H4N6O/c10-15-14-7-2-1-5-8-6(3-11-4-12-8)16-9(5)13-7/h1-4H |
| InChIKey | SKUXAETYEXGZLR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.17 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|