C15H17N3S — CID 155490313
1-cyclohepta-2,4,6-trien-1-yl-3-(cyclohepta-2,4,6-trien-1-ylamino)thiourea (PubChem CID 155490313) has the molecular formula C15H17N3S and a molecular weight of 271.39 g/mol. Its IUPAC name is 1-cyclohepta-2,4,6-trien-1-yl-3-(cyclohepta-2,4,6-trien-1-ylamino)thiourea.
| Compound Name | 1-cyclohepta-2,4,6-trien-1-yl-3-(cyclohepta-2,4,6-trien-1-ylamino)thiourea |
|---|---|
| PubChem CID | 155490313 |
| Molecular Formula | C15H17N3S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 1-cyclohepta-2,4,6-trien-1-yl-3-(cyclohepta-2,4,6-trien-1-ylamino)thiourea |
| SMILES | S=C(NNC1C=CC=CC=C1)NC1C=CC=CC=C1 |
| InChI | InChI=1S/C15H17N3S/c19-15(16-13-9-5-1-2-6-10-13)18-17-14-11-7-3-4-8-12-14/h1-14,17H,(H2,16,18,19) |
| InChIKey | REIRMMJTIFCGPI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|