C10H14N4O6 — CID 155490328
ethyl 2-[[3-(2-amino-2-oxoethyl)-2,4-dioxoimidazolidine-1-carbonyl]amino]acetate (PubChem CID 155490328) has the molecular formula C10H14N4O6 and a molecular weight of 286.24 g/mol. Its IUPAC name is ethyl 2-[[3-(2-amino-2-oxoethyl)-2,4-dioxoimidazolidine-1-carbonyl]amino]acetate.
| Compound Name | ethyl 2-[[3-(2-amino-2-oxoethyl)-2,4-dioxoimidazolidine-1-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 155490328 |
| Molecular Formula | C10H14N4O6 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | ethyl 2-[[3-(2-amino-2-oxoethyl)-2,4-dioxoimidazolidine-1-carbonyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)N1CC(=O)N(CC(N)=O)C1=O |
| InChI | InChI=1S/C10H14N4O6/c1-2-20-8(17)3-12-9(18)14-5-7(16)13(10(14)19)4-6(11)15/h2-5H2,1H3,(H2,11,15)(H,12,18) |
| InChIKey | SFNRFCVHJYTNSZ-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 139.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|