C10H4F14OS — CID 155490535
2,3,3,4,4,5,5-heptafluoro-1-(2,3,3,4,4,5,5-heptafluoropent-1-enylsulfinyl)pent-1-ene (PubChem CID 155490535) has the molecular formula C10H4F14OS and a molecular weight of 438.18 g/mol. Its IUPAC name is 2,3,3,4,4,5,5-heptafluoro-1-(2,3,3,4,4,5,5-heptafluoropent-1-enylsulfinyl)pent-1-ene.
| Compound Name | 2,3,3,4,4,5,5-heptafluoro-1-(2,3,3,4,4,5,5-heptafluoropent-1-enylsulfinyl)pent-1-ene |
|---|---|
| PubChem CID | 155490535 |
| Molecular Formula | C10H4F14OS |
| Molecular Weight | 438.18 g/mol |
| Exact Mass | 437.98 |
| IUPAC Name | 2,3,3,4,4,5,5-heptafluoro-1-(2,3,3,4,4,5,5-heptafluoropent-1-enylsulfinyl)pent-1-ene |
| SMILES | O=S(C=C(F)C(F)(F)C(F)(F)C(F)F)C=C(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H4F14OS/c11-3(7(17,18)9(21,22)5(13)14)1-26(25)2-4(12)8(19,20)10(23,24)6(15)16/h1-2,5-6H |
| InChIKey | AQJQVZPNWODLCL-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.18 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|