C23H25BN2O4 — CID 155490685
3-hydroxy-4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyliminomethyl]-2H-isoquinolin-1-one (PubChem CID 155490685) has the molecular formula C23H25BN2O4 and a molecular weight of 404.28 g/mol. Its IUPAC name is 3-hydroxy-4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyliminomethyl]-2H-isoquinolin-1-one.
| Compound Name | 3-hydroxy-4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyliminomethyl]-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 155490685 |
| Molecular Formula | C23H25BN2O4 |
| Molecular Weight | 404.28 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 3-hydroxy-4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyliminomethyl]-2H-isoquinolin-1-one |
| SMILES | CC1(C)OB(c2cccc(C/N=C/c3c(O)[nH]c(=O)c4ccccc34)c2)OC1(C)C |
| InChI | InChI=1S/C23H25BN2O4/c1-22(2)23(3,4)30-24(29-22)16-9-7-8-15(12-16)13-25-14-19-17-10-5-6-11-18(17)20(27)26-21(19)28/h5-12,14H,13H2,1-4H3,(H2,26,27,28)/b25-14+ |
| InChIKey | MGOYEPJNIMVSGV-AFUMVMLFSA-N |
| XLogP | 3.15 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.28 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|