C14H4F22S — CID 155490803
2,3,3,4,4,5,5,6,6,7,7-undecafluoro-1-(2,3,3,4,4,5,5,6,6,7,7-undecafluorohept-1-enylsulfanyl)hept-1-ene (PubChem CID 155490803) has the molecular formula C14H4F22S and a molecular weight of 622.21 g/mol. Its IUPAC name is 2,3,3,4,4,5,5,6,6,7,7-undecafluoro-1-(2,3,3,4,4,5,5,6,6,7,7-undecafluorohept-1-enylsulfanyl)hept-1-ene.
| Compound Name | 2,3,3,4,4,5,5,6,6,7,7-undecafluoro-1-(2,3,3,4,4,5,5,6,6,7,7-undecafluorohept-1-enylsulfanyl)hept-1-ene |
|---|---|
| PubChem CID | 155490803 |
| Molecular Formula | C14H4F22S |
| Molecular Weight | 622.21 g/mol |
| Exact Mass | 621.97 |
| IUPAC Name | 2,3,3,4,4,5,5,6,6,7,7-undecafluoro-1-(2,3,3,4,4,5,5,6,6,7,7-undecafluorohept-1-enylsulfanyl)hept-1-ene |
| SMILES | FC(=CSC=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C14H4F22S/c15-3(7(21,22)11(29,30)13(33,34)9(25,26)5(17)18)1-37-2-4(16)8(23,24)12(31,32)14(35,36)10(27,28)6(19)20/h1-2,5-6H |
| InChIKey | WDBISDKKOCNXJY-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.21 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|