C18H27F3N2O2 — CID 155492250
4,4,4-trifluoro-N-[[(1S,5S,6R,7R)-3-(3-methylbut-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide (PubChem CID 155492250) has the molecular formula C18H27F3N2O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[[(1S,5S,6R,7R)-3-(3-methylbut-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide.
| Compound Name | 4,4,4-trifluoro-N-[[(1S,5S,6R,7R)-3-(3-methylbut-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide |
|---|---|
| PubChem CID | 155492250 |
| Molecular Formula | C18H27F3N2O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 4,4,4-trifluoro-N-[[(1S,5S,6R,7R)-3-(3-methylbut-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide |
| SMILES | CC(C)=CCN1C[C@@H]2[C@H](CNC(=O)CCC(F)(F)F)[C@H]3CC[C@]2(C1)O3 |
| InChI | InChI=1S/C18H27F3N2O2/c1-12(2)5-8-23-10-14-13(15-3-6-17(14,11-23)25-15)9-22-16(24)4-7-18(19,20)21/h5,13-15H,3-4,6-11H2,1-2H3,(H,22,24)/t13-,14+,15+,17+/m0/s1 |
| InChIKey | AEWJWBPBWITQJI-KLZNWCGWSA-N |
| XLogP | 2.89 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|