C20H32F2N2O2 — CID 155492735
N-[[(1S,5S,6R,7R)-3-[(4,4-difluorocyclohexyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide (PubChem CID 155492735) has the molecular formula C20H32F2N2O2 and a molecular weight of 370.48 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-[(4,4-difluorocyclohexyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide.
| Compound Name | N-[[(1S,5S,6R,7R)-3-[(4,4-difluorocyclohexyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide |
|---|---|
| PubChem CID | 155492735 |
| Molecular Formula | C20H32F2N2O2 |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-[(4,4-difluorocyclohexyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide |
| SMILES | CCCC(=O)NC[C@H]1[C@H]2CN(CC3CCC(F)(F)CC3)C[C@]23CC[C@H]1O3 |
| InChI | InChI=1S/C20H32F2N2O2/c1-2-3-18(25)23-10-15-16-12-24(13-19(16)7-6-17(15)26-19)11-14-4-8-20(21,22)9-5-14/h14-17H,2-13H2,1H3,(H,23,25)/t15-,16+,17+,19+/m0/s1 |
| InChIKey | GVOFLUXROAPTNF-DODZYUBVSA-N |
| XLogP | 3.21 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |