C19H26N2O4S — CID 155492887
N-[[(1S,5S,6R,7R)-3-(2-propylsulfanylacetyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]furan-3-carboxamide (PubChem CID 155492887) has the molecular formula C19H26N2O4S and a molecular weight of 378.49 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-(2-propylsulfanylacetyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]furan-3-carboxamide.
| Compound Name | N-[[(1S,5S,6R,7R)-3-(2-propylsulfanylacetyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 155492887 |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-(2-propylsulfanylacetyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]furan-3-carboxamide |
| SMILES | CCCSCC(=O)N1C[C@@H]2[C@H](CNC(=O)c3ccoc3)[C@H]3CC[C@]2(C1)O3 |
| InChI | InChI=1S/C19H26N2O4S/c1-2-7-26-11-17(22)21-9-15-14(16-3-5-19(15,12-21)25-16)8-20-18(23)13-4-6-24-10-13/h4,6,10,14-16H,2-3,5,7-9,11-12H2,1H3,(H,20,23)/t14-,15+,16+,19+/m0/s1 |
| InChIKey | NAPOTUQJLABTFC-WFXMFSGNSA-N |
| XLogP | 2.16 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|