About [(2R,4S)-4-[2-(4-methyl-1,3-thiazol-5-yl)imidazol-1-yl]pyrrolidin-2-yl]methanol
[(2R,4S)-4-[2-(4-methyl-1,3-thiazol-5-yl)imidazol-1-yl]pyrrolidin-2-yl]methanol (PubChem CID 155493928) has the molecular formula C12H16N4OS
and a molecular weight of 264.35 g/mol. Its IUPAC name is [(2R,4S)-4-[2-(4-methyl-1,3-thiazol-5-yl)imidazol-1-yl]pyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [(2R,4S)-4-[2-(4-methyl-1,3-thiazol-5-yl)imidazol-1-yl]pyrrolidin-2-yl]methanol |
| PubChem CID | 155493928 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | [(2R,4S)-4-[2-(4-methyl-1,3-thiazol-5-yl)imidazol-1-yl]pyrrolidin-2-yl]methanol |
| SMILES | Cc1ncsc1-c1nccn1[C@@H]1CN[C@@H](CO)C1 |
| InChI | InChI=1S/C12H16N4OS/c1-8-11(18-7-15-8)12-13-2-3-16(12)10-4-9(6-17)14-5-10/h2-3,7,9-10,14,17H,4-6H2,1H3/t9-,10+/m1/s1 |
| InChIKey | RTLDRFPQWINLPQ-ZJUUUORDSA-N |
| XLogP | 1.21 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(2R,4S)-4-[2-(4-methyl-1,3-thiazol-5-yl)imidazol-1-yl]pyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,4S)-4-[2-(4-methyl-1,3-thiazol-5-yl)imidazol-1-yl]pyrrolidin-2-yl]methanol?
The IUPAC name of [(2R,4S)-4-[2-(4-methyl-1,3-thiazol-5-yl)imidazol-1-yl]pyrrolidin-2-yl]methanol (CID 155493928) is [(2R,4S)-4-[2-(4-methyl-1,3-thiazol-5-yl)imidazol-1-yl]pyrrolidin-2-yl]methanol.
What is the SMILES notation for [(2R,4S)-4-[2-(4-methyl-1,3-thiazol-5-yl)imidazol-1-yl]pyrrolidin-2-yl]methanol?
The canonical SMILES for [(2R,4S)-4-[2-(4-methyl-1,3-thiazol-5-yl)imidazol-1-yl]pyrrolidin-2-yl]methanol is Cc1ncsc1-c1nccn1[C@@H]1CN[C@@H](CO)C1.
What is the InChIKey of [(2R,4S)-4-[2-(4-methyl-1,3-thiazol-5-yl)imidazol-1-yl]pyrrolidin-2-yl]methanol?
The InChIKey is RTLDRFPQWINLPQ-ZJUUUORDSA-N. The full InChI is InChI=1S/C12H16N4OS/c1-8-11(18-7-15-8)12-13-2-3-16(12)10-4-9(6-17)14-5-10/h2-3,7,9-10,14,17H,4-6H2,1H3/t9-,10+/m1/s1.
What are the key properties of [(2R,4S)-4-[2-(4-methyl-1,3-thiazol-5-yl)imidazol-1-yl]pyrrolidin-2-yl]methanol?
[(2R,4S)-4-[2-(4-methyl-1,3-thiazol-5-yl)imidazol-1-yl]pyrrolidin-2-yl]methanol has a molecular weight of 264.35 g/mol, XLogP of 1.21, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,4S)-4-[2-(4-methyl-1,3-thiazol-5-yl)imidazol-1-yl]pyrrolidin-2-yl]methanol is sourced from PubChem (CID 155493928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).