C18H26N4O3 — CID 155494668
1-[3-[(1R,2S,9R)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-3-oxopropyl]pyrimidine-2,4-dione (PubChem CID 155494668) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-[3-[(1R,2S,9R)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-3-oxopropyl]pyrimidine-2,4-dione.
| Compound Name | 1-[3-[(1R,2S,9R)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-3-oxopropyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 155494668 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 1-[3-[(1R,2S,9R)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-3-oxopropyl]pyrimidine-2,4-dione |
| SMILES | O=C(CCn1ccc(=O)[nH]c1=O)N1C[C@@H]2C[C@H](C1)[C@@H]1CCCCN1C2 |
| InChI | InChI=1S/C18H26N4O3/c23-16-4-7-20(18(25)19-16)8-5-17(24)22-11-13-9-14(12-22)15-3-1-2-6-21(15)10-13/h4,7,13-15H,1-3,5-6,8-12H2,(H,19,23,25)/t13-,14-,15+/m1/s1 |
| InChIKey | MFQPXERRRZUSQD-KFWWJZLASA-N |
| XLogP | 0.26 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |