C21H32N4O3 — CID 155495760
3,3-dimethyl-N-[[(1S,5S,6R,7R)-3-[2-(3-methylpyrazol-1-yl)acetyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide (PubChem CID 155495760) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is 3,3-dimethyl-N-[[(1S,5S,6R,7R)-3-[2-(3-methylpyrazol-1-yl)acetyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide.
| Compound Name | 3,3-dimethyl-N-[[(1S,5S,6R,7R)-3-[2-(3-methylpyrazol-1-yl)acetyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide |
|---|---|
| PubChem CID | 155495760 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | 3,3-dimethyl-N-[[(1S,5S,6R,7R)-3-[2-(3-methylpyrazol-1-yl)acetyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide |
| SMILES | Cc1ccn(CC(=O)N2C[C@@H]3[C@H](CNC(=O)CC(C)(C)C)[C@H]4CC[C@]3(C2)O4)n1 |
| InChI | InChI=1S/C21H32N4O3/c1-14-6-8-25(23-14)12-19(27)24-11-16-15(10-22-18(26)9-20(2,3)4)17-5-7-21(16,13-24)28-17/h6,8,15-17H,5,7,9-13H2,1-4H3,(H,22,26)/t15-,16+,17+,21+/m0/s1 |
| InChIKey | WADYQNVWBLYOAN-BIZBXSGISA-N |
| XLogP | 1.75 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |