About (E)-1-(1,3-benzothiazol-2-yl)-3-(1-benzylpiperidin-4-yl)prop-2-en-1-ol
(E)-1-(1,3-benzothiazol-2-yl)-3-(1-benzylpiperidin-4-yl)prop-2-en-1-ol (PubChem CID 15549618) has the molecular formula C22H24N2OS
and a molecular weight of 364.51 g/mol. Its IUPAC name is (E)-1-(1,3-benzothiazol-2-yl)-3-(1-benzylpiperidin-4-yl)prop-2-en-1-ol.
Molecular Properties
| Compound Name | (E)-1-(1,3-benzothiazol-2-yl)-3-(1-benzylpiperidin-4-yl)prop-2-en-1-ol |
| PubChem CID | 15549618 |
| Molecular Formula | C22H24N2OS |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | (E)-1-(1,3-benzothiazol-2-yl)-3-(1-benzylpiperidin-4-yl)prop-2-en-1-ol |
| SMILES | OC(/C=C/C1CCN(Cc2ccccc2)CC1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C22H24N2OS/c25-20(22-23-19-8-4-5-9-21(19)26-22)11-10-17-12-14-24(15-13-17)16-18-6-2-1-3-7-18/h1-11,17,20,25H,12-16H2/b11-10+ |
| InChIKey | NXRZDBNUUKWRKT-ZHACJKMWSA-N |
| XLogP | 4.80 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(1,3-benzothiazol-2-yl)-3-(1-benzylpiperidin-4-yl)prop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(1,3-benzothiazol-2-yl)-3-(1-benzylpiperidin-4-yl)prop-2-en-1-ol?
The IUPAC name of (E)-1-(1,3-benzothiazol-2-yl)-3-(1-benzylpiperidin-4-yl)prop-2-en-1-ol (CID 15549618) is (E)-1-(1,3-benzothiazol-2-yl)-3-(1-benzylpiperidin-4-yl)prop-2-en-1-ol.
What is the SMILES notation for (E)-1-(1,3-benzothiazol-2-yl)-3-(1-benzylpiperidin-4-yl)prop-2-en-1-ol?
The canonical SMILES for (E)-1-(1,3-benzothiazol-2-yl)-3-(1-benzylpiperidin-4-yl)prop-2-en-1-ol is OC(/C=C/C1CCN(Cc2ccccc2)CC1)c1nc2ccccc2s1.
What is the InChIKey of (E)-1-(1,3-benzothiazol-2-yl)-3-(1-benzylpiperidin-4-yl)prop-2-en-1-ol?
The InChIKey is NXRZDBNUUKWRKT-ZHACJKMWSA-N. The full InChI is InChI=1S/C22H24N2OS/c25-20(22-23-19-8-4-5-9-21(19)26-22)11-10-17-12-14-24(15-13-17)16-18-6-2-1-3-7-18/h1-11,17,20,25H,12-16H2/b11-10+.
What are the key properties of (E)-1-(1,3-benzothiazol-2-yl)-3-(1-benzylpiperidin-4-yl)prop-2-en-1-ol?
(E)-1-(1,3-benzothiazol-2-yl)-3-(1-benzylpiperidin-4-yl)prop-2-en-1-ol has a molecular weight of 364.51 g/mol, XLogP of 4.80, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(1,3-benzothiazol-2-yl)-3-(1-benzylpiperidin-4-yl)prop-2-en-1-ol is sourced from PubChem (CID 15549618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).