C20H24FN3O3 — CID 155496257
N-[(3S,7R,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-7-fluoro-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 155496257) has the molecular formula C20H24FN3O3 and a molecular weight of 373.43 g/mol. Its IUPAC name is N-[(3S,7R,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-7-fluoro-2-oxo-1H-quinoline-4-carboxamide.
| Compound Name | N-[(3S,7R,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-7-fluoro-2-oxo-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 155496257 |
| Molecular Formula | C20H24FN3O3 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-[(3S,7R,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-7-fluoro-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | CC(C)C1CN2C[C@H](NC(=O)c3cc(=O)[nH]c4cc(F)ccc34)C[C@H]2CO1 |
| InChI | InChI=1S/C20H24FN3O3/c1-11(2)18-9-24-8-13(6-14(24)10-27-18)22-20(26)16-7-19(25)23-17-5-12(21)3-4-15(16)17/h3-5,7,11,13-14,18H,6,8-10H2,1-2H3,(H,22,26)(H,23,25)/t13-,14+,18?/m1/s1 |
| InChIKey | PNZWVMGEYUAFMI-RMAOKOMNSA-N |
| XLogP | 1.89 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |