C23H27ClN4O2 — CID 155496525
4-chloro-N-[[(1S,5S,6R,7R)-3-(2,3-dihydro-1H-inden-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1-methylpyrazole-5-carboxamide (PubChem CID 155496525) has the molecular formula C23H27ClN4O2 and a molecular weight of 426.95 g/mol. Its IUPAC name is 4-chloro-N-[[(1S,5S,6R,7R)-3-(2,3-dihydro-1H-inden-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1-methylpyrazole-5-carboxamide.
| Compound Name | 4-chloro-N-[[(1S,5S,6R,7R)-3-(2,3-dihydro-1H-inden-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 155496525 |
| Molecular Formula | C23H27ClN4O2 |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 4-chloro-N-[[(1S,5S,6R,7R)-3-(2,3-dihydro-1H-inden-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1-methylpyrazole-5-carboxamide |
| SMILES | Cn1ncc(Cl)c1C(=O)NC[C@H]1[C@H]2CN(C3Cc4ccccc4C3)C[C@]23CC[C@H]1O3 |
| InChI | InChI=1S/C23H27ClN4O2/c1-27-21(19(24)11-26-27)22(29)25-10-17-18-12-28(13-23(18)7-6-20(17)30-23)16-8-14-4-2-3-5-15(14)9-16/h2-5,11,16-18,20H,6-10,12-13H2,1H3,(H,25,29)/t17-,18+,20+,23+/m0/s1 |
| InChIKey | DCPYTNPYENAYCJ-XNSSQMBPSA-N |
| XLogP | 2.45 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |