C21H24N4O — CID 155497225
2-[[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]amino]-4,6-dimethylpyridine-3-carbonitrile (PubChem CID 155497225) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-[[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]amino]-4,6-dimethylpyridine-3-carbonitrile.
| Compound Name | 2-[[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]amino]-4,6-dimethylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 155497225 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 2-[[(3S,7S,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]amino]-4,6-dimethylpyridine-3-carbonitrile |
| SMILES | Cc1cc(C)c(C#N)c(N[C@H]2C[C@H]3CO[C@@H](c4ccccc4)CN3C2)n1 |
| InChI | InChI=1S/C21H24N4O/c1-14-8-15(2)23-21(19(14)10-22)24-17-9-18-13-26-20(12-25(18)11-17)16-6-4-3-5-7-16/h3-8,17-18,20H,9,11-13H2,1-2H3,(H,23,24)/t17-,18-,20+/m0/s1 |
| InChIKey | HCWGWBGPUXBZPW-CMKODMSKSA-N |
| XLogP | 3.20 |
| TPSA | 61.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |