C22H24F6N2O — CID 15549736
(2S,3S)-N-[[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methoxyphenyl]methyl]-2-phenylpiperidin-3-amine (PubChem CID 15549736) has the molecular formula C22H24F6N2O and a molecular weight of 446.44 g/mol. Its IUPAC name is (2S,3S)-N-[[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methoxyphenyl]methyl]-2-phenylpiperidin-3-amine.
| Compound Name | (2S,3S)-N-[[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methoxyphenyl]methyl]-2-phenylpiperidin-3-amine |
|---|---|
| PubChem CID | 15549736 |
| Molecular Formula | C22H24F6N2O |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | (2S,3S)-N-[[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methoxyphenyl]methyl]-2-phenylpiperidin-3-amine |
| SMILES | COc1ccc(C(C(F)(F)F)C(F)(F)F)cc1CN[C@H]1CCCN[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H24F6N2O/c1-31-18-10-9-15(20(21(23,24)25)22(26,27)28)12-16(18)13-30-17-8-5-11-29-19(17)14-6-3-2-4-7-14/h2-4,6-7,9-10,12,17,19-20,29-30H,5,8,11,13H2,1H3/t17-,19-/m0/s1 |
| InChIKey | XOHNGGNSGAFTFL-HKUYNNGSSA-N |
| XLogP | 5.49 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |