C19H23N3O2 — CID 155497782
2-[(1S,5S,6R,7R)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]-5,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 155497782) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 2-[(1S,5S,6R,7R)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]-5,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-[(1S,5S,6R,7R)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 155497782 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 2-[(1S,5S,6R,7R)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | N#Cc1cc2c(nc1N1C[C@@H]3[C@H](CO)[C@H]4CC[C@]3(C1)O4)CCCC2 |
| InChI | InChI=1S/C19H23N3O2/c20-8-13-7-12-3-1-2-4-16(12)21-18(13)22-9-15-14(10-23)17-5-6-19(15,11-22)24-17/h7,14-15,17,23H,1-6,9-11H2/t14-,15+,17+,19+/m0/s1 |
| InChIKey | MGEXKKNRJILUCT-BUIAKZPTSA-N |
| XLogP | 1.81 |
| TPSA | 69.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |