C17H20F3NO3 — CID 155498028
4,4,4-trifluoro-1-[(1R,2S,3R,4S)-4-hydroxy-1-(hydroxymethyl)-2-phenyl-6-azaspiro[2.4]heptan-6-yl]butan-1-one (PubChem CID 155498028) has the molecular formula C17H20F3NO3 and a molecular weight of 343.35 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-[(1R,2S,3R,4S)-4-hydroxy-1-(hydroxymethyl)-2-phenyl-6-azaspiro[2.4]heptan-6-yl]butan-1-one.
| Compound Name | 4,4,4-trifluoro-1-[(1R,2S,3R,4S)-4-hydroxy-1-(hydroxymethyl)-2-phenyl-6-azaspiro[2.4]heptan-6-yl]butan-1-one |
|---|---|
| PubChem CID | 155498028 |
| Molecular Formula | C17H20F3NO3 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 4,4,4-trifluoro-1-[(1R,2S,3R,4S)-4-hydroxy-1-(hydroxymethyl)-2-phenyl-6-azaspiro[2.4]heptan-6-yl]butan-1-one |
| SMILES | O=C(CCC(F)(F)F)N1C[C@@H](O)[C@@]2(C1)[C@H](CO)[C@H]2c1ccccc1 |
| InChI | InChI=1S/C17H20F3NO3/c18-17(19,20)7-6-14(24)21-8-13(23)16(10-21)12(9-22)15(16)11-4-2-1-3-5-11/h1-5,12-13,15,22-23H,6-10H2/t12-,13-,15-,16-/m1/s1 |
| InChIKey | OGIGRZQTMLPKAK-RRCSTGOVSA-N |
| XLogP | 1.92 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |