C15H21N5O2 — CID 155498358
N-[(3S,7S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-methylimidazo[2,1-e]pyrazole-7-carboxamide (PubChem CID 155498358) has the molecular formula C15H21N5O2 and a molecular weight of 303.37 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-methylimidazo[2,1-e]pyrazole-7-carboxamide.
| Compound Name | N-[(3S,7S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-methylimidazo[2,1-e]pyrazole-7-carboxamide |
|---|---|
| PubChem CID | 155498358 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | N-[(3S,7S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-methylimidazo[2,1-e]pyrazole-7-carboxamide |
| SMILES | C[C@H]1CN2C[C@@H](NC(=O)c3cnn4ccn(C)c34)C[C@H]2CO1 |
| InChI | InChI=1S/C15H21N5O2/c1-10-7-19-8-11(5-12(19)9-22-10)17-14(21)13-6-16-20-4-3-18(2)15(13)20/h3-4,6,10-12H,5,7-9H2,1-2H3,(H,17,21)/t10-,11-,12-/m0/s1 |
| InChIKey | GWQZYZMKCLNVPR-SRVKXCTJSA-N |
| XLogP | 0.26 |
| TPSA | 63.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |