About 2-[4-(Methanesulfonyl)phenyl]-2-oxoethyl phenylacetate
2-[4-(Methanesulfonyl)phenyl]-2-oxoethyl phenylacetate (PubChem CID 15549911) has the molecular formula C17H16O5S
and a molecular weight of 332.40 g/mol. Its IUPAC name is [2-(4-methylsulfonylphenyl)-2-oxoethyl] 2-phenylacetate.
Molecular Properties
| Compound Name | 2-[4-(Methanesulfonyl)phenyl]-2-oxoethyl phenylacetate |
| PubChem CID | 15549911 |
| Molecular Formula | C17H16O5S |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | [2-(4-methylsulfonylphenyl)-2-oxoethyl] 2-phenylacetate |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C(=O)COC(=O)CC2=CC=CC=C2 |
| InChI | InChI=1S/C17H16O5S/c1-23(20,21)15-9-7-14(8-10-15)16(18)12-22-17(19)11-13-5-3-2-4-6-13/h2-10H,11-12H2,1H3 |
| InChIKey | FFGBLORBEKAYGC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 85.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | 506 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(Methanesulfonyl)phenyl]-2-oxoethyl phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(Methanesulfonyl)phenyl]-2-oxoethyl phenylacetate?
The IUPAC name of 2-[4-(Methanesulfonyl)phenyl]-2-oxoethyl phenylacetate (CID 15549911) is [2-(4-methylsulfonylphenyl)-2-oxoethyl] 2-phenylacetate.
What is the SMILES notation for 2-[4-(Methanesulfonyl)phenyl]-2-oxoethyl phenylacetate?
The canonical SMILES for 2-[4-(Methanesulfonyl)phenyl]-2-oxoethyl phenylacetate is CS(=O)(=O)C1=CC=C(C=C1)C(=O)COC(=O)CC2=CC=CC=C2.
What is the InChIKey of 2-[4-(Methanesulfonyl)phenyl]-2-oxoethyl phenylacetate?
The InChIKey is FFGBLORBEKAYGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O5S/c1-23(20,21)15-9-7-14(8-10-15)16(18)12-22-17(19)11-13-5-3-2-4-6-13/h2-10H,11-12H2,1H3.
What are the key properties of 2-[4-(Methanesulfonyl)phenyl]-2-oxoethyl phenylacetate?
2-[4-(Methanesulfonyl)phenyl]-2-oxoethyl phenylacetate has a molecular weight of 332.40 g/mol, XLogP of 2.40, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(Methanesulfonyl)phenyl]-2-oxoethyl phenylacetate is sourced from PubChem (CID 15549911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).