About 2-methylpropyl N-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]carbamate
2-methylpropyl N-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]carbamate (PubChem CID 15550049) has the molecular formula C16H20FNO2S
and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-methylpropyl N-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]carbamate.
Molecular Properties
| Compound Name | 2-methylpropyl N-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]carbamate |
| PubChem CID | 15550049 |
| Molecular Formula | C16H20FNO2S |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 2-methylpropyl N-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]carbamate |
| SMILES | CC(C)COC(=O)Nc1ccc(C2=CCSCC2)c(F)c1 |
| InChI | InChI=1S/C16H20FNO2S/c1-11(2)10-20-16(19)18-13-3-4-14(15(17)9-13)12-5-7-21-8-6-12/h3-5,9,11H,6-8,10H2,1-2H3,(H,18,19) |
| InChIKey | RVGUBBSEUVHGNN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylpropyl N-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl N-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]carbamate?
The IUPAC name of 2-methylpropyl N-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]carbamate (CID 15550049) is 2-methylpropyl N-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]carbamate.
What is the SMILES notation for 2-methylpropyl N-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]carbamate?
The canonical SMILES for 2-methylpropyl N-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]carbamate is CC(C)COC(=O)Nc1ccc(C2=CCSCC2)c(F)c1.
What is the InChIKey of 2-methylpropyl N-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]carbamate?
The InChIKey is RVGUBBSEUVHGNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20FNO2S/c1-11(2)10-20-16(19)18-13-3-4-14(15(17)9-13)12-5-7-21-8-6-12/h3-5,9,11H,6-8,10H2,1-2H3,(H,18,19).
What are the key properties of 2-methylpropyl N-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]carbamate?
2-methylpropyl N-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]carbamate has a molecular weight of 309.41 g/mol, XLogP of 4.55, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl N-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]carbamate is sourced from PubChem (CID 15550049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).