C13H23NO5 — CID 15550092
acetyloxymethyl 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylate (PubChem CID 15550092) has the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. Its IUPAC name is acetyloxymethyl 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylate.
| Compound Name | acetyloxymethyl 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 15550092 |
| Molecular Formula | C13H23NO5 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | acetyloxymethyl 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylate |
| SMILES | CC(=O)OCOC(=O)C1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C13H23NO5/c1-9(15)18-8-19-11(16)10-6-12(2,3)14(17)13(4,5)7-10/h10,17H,6-8H2,1-5H3 |
| InChIKey | JOVQNTDHTZADOG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|