C14H25NO5 — CID 15550098
propanoyloxymethyl 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylate (PubChem CID 15550098) has the molecular formula C14H25NO5 and a molecular weight of 287.36 g/mol. Its IUPAC name is propanoyloxymethyl 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylate.
| Compound Name | propanoyloxymethyl 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 15550098 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | propanoyloxymethyl 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylate |
| SMILES | CCC(=O)OCOC(=O)C1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C14H25NO5/c1-6-11(16)19-9-20-12(17)10-7-13(2,3)15(18)14(4,5)8-10/h10,18H,6-9H2,1-5H3 |
| InChIKey | NTRIMIJQJSEOHG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|