C18H27F3N2O3 — CID 155501643
4,4,4-trifluoro-N-[[(1S,5S,6R,7R)-3-(oxan-4-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide (PubChem CID 155501643) has the molecular formula C18H27F3N2O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[[(1S,5S,6R,7R)-3-(oxan-4-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide.
| Compound Name | 4,4,4-trifluoro-N-[[(1S,5S,6R,7R)-3-(oxan-4-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide |
|---|---|
| PubChem CID | 155501643 |
| Molecular Formula | C18H27F3N2O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 4,4,4-trifluoro-N-[[(1S,5S,6R,7R)-3-(oxan-4-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide |
| SMILES | O=C(CCC(F)(F)F)NC[C@H]1[C@H]2CN(C3CCOCC3)C[C@]23CC[C@H]1O3 |
| InChI | InChI=1S/C18H27F3N2O3/c19-18(20,21)6-2-16(24)22-9-13-14-10-23(12-3-7-25-8-4-12)11-17(14)5-1-15(13)26-17/h12-15H,1-11H2,(H,22,24)/t13-,14+,15+,17+/m0/s1 |
| InChIKey | OPGPXPANPYLMQI-KLZNWCGWSA-N |
| XLogP | 2.10 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |