C17H20N4O2 — CID 155501840
(3aR,7aS)-5-methyl-2-(3-methylimidazo[1,2-a]pyridine-2-carbonyl)-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one (PubChem CID 155501840) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is (3aR,7aS)-5-methyl-2-(3-methylimidazo[1,2-a]pyridine-2-carbonyl)-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one.
| Compound Name | (3aR,7aS)-5-methyl-2-(3-methylimidazo[1,2-a]pyridine-2-carbonyl)-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 155501840 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (3aR,7aS)-5-methyl-2-(3-methylimidazo[1,2-a]pyridine-2-carbonyl)-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
| SMILES | Cc1c(C(=O)N2C[C@H]3CCN(C)C(=O)[C@H]3C2)nc2ccccn12 |
| InChI | InChI=1S/C17H20N4O2/c1-11-15(18-14-5-3-4-7-21(11)14)17(23)20-9-12-6-8-19(2)16(22)13(12)10-20/h3-5,7,12-13H,6,8-10H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | BDFGXFKKRALQAD-OLZOCXBDSA-N |
| XLogP | 1.19 |
| TPSA | 57.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |