C17H20N6O2 — CID 155501885
1,3-dimethyl-8-(6-methylpyrido[3,2-d]pyrimidin-4-yl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 155501885) has the molecular formula C17H20N6O2 and a molecular weight of 340.39 g/mol. Its IUPAC name is 1,3-dimethyl-8-(6-methylpyrido[3,2-d]pyrimidin-4-yl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1,3-dimethyl-8-(6-methylpyrido[3,2-d]pyrimidin-4-yl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 155501885 |
| Molecular Formula | C17H20N6O2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1,3-dimethyl-8-(6-methylpyrido[3,2-d]pyrimidin-4-yl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1ccc2ncnc(N3CCC4(CC3)C(=O)N(C)C(=O)N4C)c2n1 |
| InChI | InChI=1S/C17H20N6O2/c1-11-4-5-12-13(20-11)14(19-10-18-12)23-8-6-17(7-9-23)15(24)21(2)16(25)22(17)3/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | WUBRFDOFTFRRPC-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 82.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|