C15H22N4O4 — CID 155502067
ethyl 4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carbonylamino)oxane-4-carboxylate (PubChem CID 155502067) has the molecular formula C15H22N4O4 and a molecular weight of 322.37 g/mol. Its IUPAC name is ethyl 4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carbonylamino)oxane-4-carboxylate.
| Compound Name | ethyl 4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carbonylamino)oxane-4-carboxylate |
|---|---|
| PubChem CID | 155502067 |
| Molecular Formula | C15H22N4O4 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | ethyl 4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carbonylamino)oxane-4-carboxylate |
| SMILES | CCOC(=O)C1(NC(=O)C2CCc3ncnn3C2)CCOCC1 |
| InChI | InChI=1S/C15H22N4O4/c1-2-23-14(21)15(5-7-22-8-6-15)18-13(20)11-3-4-12-16-10-17-19(12)9-11/h10-11H,2-9H2,1H3,(H,18,20) |
| InChIKey | PYTDBBMUORUBNK-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |