C21H19N5O3 — CID 155502117
(1S,3R,8R)-3-phenyl-9-(1H-pyrazolo[5,4-b]pyridine-6-carbonyl)-2-oxa-5,9-diazatricyclo[6.3.0.01,5]undecan-6-one (PubChem CID 155502117) has the molecular formula C21H19N5O3 and a molecular weight of 389.42 g/mol. Its IUPAC name is (1S,3R,8R)-3-phenyl-9-(1H-pyrazolo[5,4-b]pyridine-6-carbonyl)-2-oxa-5,9-diazatricyclo[6.3.0.01,5]undecan-6-one.
| Compound Name | (1S,3R,8R)-3-phenyl-9-(1H-pyrazolo[5,4-b]pyridine-6-carbonyl)-2-oxa-5,9-diazatricyclo[6.3.0.01,5]undecan-6-one |
|---|---|
| PubChem CID | 155502117 |
| Molecular Formula | C21H19N5O3 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | (1S,3R,8R)-3-phenyl-9-(1H-pyrazolo[5,4-b]pyridine-6-carbonyl)-2-oxa-5,9-diazatricyclo[6.3.0.01,5]undecan-6-one |
| SMILES | O=C(c1ccc2cn[nH]c2n1)N1CC[C@@]23O[C@H](c4ccccc4)CN2C(=O)C[C@@H]13 |
| InChI | InChI=1S/C21H19N5O3/c27-18-10-17-21(26(18)12-16(29-21)13-4-2-1-3-5-13)8-9-25(17)20(28)15-7-6-14-11-22-24-19(14)23-15/h1-7,11,16-17H,8-10,12H2,(H,22,23,24)/t16-,17+,21-/m0/s1 |
| InChIKey | YBJVJZBVZXBGGC-FVJLSDCUSA-N |
| XLogP | 1.87 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |