About N-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1-pyridazin-3-ylpiperidin-4-amine
N-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1-pyridazin-3-ylpiperidin-4-amine (PubChem CID 155502909) has the molecular formula C17H19ClN4O2
and a molecular weight of 346.82 g/mol. Its IUPAC name is N-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1-pyridazin-3-ylpiperidin-4-amine.
Molecular Properties
| Compound Name | N-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1-pyridazin-3-ylpiperidin-4-amine |
| PubChem CID | 155502909 |
| Molecular Formula | C17H19ClN4O2 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | N-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1-pyridazin-3-ylpiperidin-4-amine |
| SMILES | Clc1cc2c(cc1CNC1CCN(c3cccnn3)CC1)OCO2 |
| InChI | InChI=1S/C17H19ClN4O2/c18-14-9-16-15(23-11-24-16)8-12(14)10-19-13-3-6-22(7-4-13)17-2-1-5-20-21-17/h1-2,5,8-9,13,19H,3-4,6-7,10-11H2 |
| InChIKey | FSDIGESQBUBMEG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1-pyridazin-3-ylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1-pyridazin-3-ylpiperidin-4-amine?
The IUPAC name of N-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1-pyridazin-3-ylpiperidin-4-amine (CID 155502909) is N-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1-pyridazin-3-ylpiperidin-4-amine.
What is the SMILES notation for N-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1-pyridazin-3-ylpiperidin-4-amine?
The canonical SMILES for N-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1-pyridazin-3-ylpiperidin-4-amine is Clc1cc2c(cc1CNC1CCN(c3cccnn3)CC1)OCO2.
What is the InChIKey of N-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1-pyridazin-3-ylpiperidin-4-amine?
The InChIKey is FSDIGESQBUBMEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19ClN4O2/c18-14-9-16-15(23-11-24-16)8-12(14)10-19-13-3-6-22(7-4-13)17-2-1-5-20-21-17/h1-2,5,8-9,13,19H,3-4,6-7,10-11H2.
What are the key properties of N-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1-pyridazin-3-ylpiperidin-4-amine?
N-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1-pyridazin-3-ylpiperidin-4-amine has a molecular weight of 346.82 g/mol, XLogP of 2.62, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1-pyridazin-3-ylpiperidin-4-amine is sourced from PubChem (CID 155502909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).