C20H23N3O — CID 155503395
[(1S,3R)-3-[2-(6-methylquinolin-5-yl)imidazol-1-yl]cyclohexyl]methanol (PubChem CID 155503395) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is [(1S,3R)-3-[2-(6-methylquinolin-5-yl)imidazol-1-yl]cyclohexyl]methanol.
| Compound Name | [(1S,3R)-3-[2-(6-methylquinolin-5-yl)imidazol-1-yl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 155503395 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | [(1S,3R)-3-[2-(6-methylquinolin-5-yl)imidazol-1-yl]cyclohexyl]methanol |
| SMILES | Cc1ccc2ncccc2c1-c1nccn1[C@@H]1CCC[C@H](CO)C1 |
| InChI | InChI=1S/C20H23N3O/c1-14-7-8-18-17(6-3-9-21-18)19(14)20-22-10-11-23(20)16-5-2-4-15(12-16)13-24/h3,6-11,15-16,24H,2,4-5,12-13H2,1H3/t15-,16+/m0/s1 |
| InChIKey | KXMYTOUQUZYICD-JKSUJKDBSA-N |
| XLogP | 4.13 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |