C19H22N4O4S — CID 155503820
(1S,3R,8R)-9-(2,5-dimethylpyrazol-3-yl)sulfonyl-3-phenyl-2-oxa-5,9-diazatricyclo[6.3.0.01,5]undecan-6-one (PubChem CID 155503820) has the molecular formula C19H22N4O4S and a molecular weight of 402.48 g/mol. Its IUPAC name is (1S,3R,8R)-9-(2,5-dimethylpyrazol-3-yl)sulfonyl-3-phenyl-2-oxa-5,9-diazatricyclo[6.3.0.01,5]undecan-6-one.
| Compound Name | (1S,3R,8R)-9-(2,5-dimethylpyrazol-3-yl)sulfonyl-3-phenyl-2-oxa-5,9-diazatricyclo[6.3.0.01,5]undecan-6-one |
|---|---|
| PubChem CID | 155503820 |
| Molecular Formula | C19H22N4O4S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | (1S,3R,8R)-9-(2,5-dimethylpyrazol-3-yl)sulfonyl-3-phenyl-2-oxa-5,9-diazatricyclo[6.3.0.01,5]undecan-6-one |
| SMILES | Cc1cc(S(=O)(=O)N2CC[C@@]34O[C@H](c5ccccc5)CN3C(=O)C[C@@H]24)n(C)n1 |
| InChI | InChI=1S/C19H22N4O4S/c1-13-10-18(21(2)20-13)28(25,26)23-9-8-19-16(23)11-17(24)22(19)12-15(27-19)14-6-4-3-5-7-14/h3-7,10,15-16H,8-9,11-12H2,1-2H3/t15-,16+,19-/m0/s1 |
| InChIKey | WMSPMMFGMGGKPL-FCEWJHQRSA-N |
| XLogP | 1.19 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |