C29H39N7O2 — CID 155504095
7-[[1-(3,4-dimethylphenyl)pyrazol-4-yl]methyl]-12,17-dimethyl-3,7,12,17,18-pentazatricyclo[11.5.2.016,19]icosa-1(18),16(19)-diene-2,11-dione (PubChem CID 155504095) has the molecular formula C29H39N7O2 and a molecular weight of 517.68 g/mol. Its IUPAC name is 7-[[1-(3,4-dimethylphenyl)pyrazol-4-yl]methyl]-12,17-dimethyl-3,7,12,17,18-pentazatricyclo[11.5.2.016,19]icosa-1(18),16(19)-diene-2,11-dione.
| Compound Name | 7-[[1-(3,4-dimethylphenyl)pyrazol-4-yl]methyl]-12,17-dimethyl-3,7,12,17,18-pentazatricyclo[11.5.2.016,19]icosa-1(18),16(19)-diene-2,11-dione |
|---|---|
| PubChem CID | 155504095 |
| Molecular Formula | C29H39N7O2 |
| Molecular Weight | 517.68 g/mol |
| Exact Mass | 517.32 |
| IUPAC Name | 7-[[1-(3,4-dimethylphenyl)pyrazol-4-yl]methyl]-12,17-dimethyl-3,7,12,17,18-pentazatricyclo[11.5.2.016,19]icosa-1(18),16(19)-diene-2,11-dione |
| SMILES | Cc1ccc(-n2cc(CN3CCCNC(=O)c4nn(C)c5c4CC(CC5)N(C)C(=O)CCC3)cn2)cc1C |
| InChI | InChI=1S/C29H39N7O2/c1-20-8-9-24(15-21(20)2)36-19-22(17-31-36)18-35-13-5-7-27(37)33(3)23-10-11-26-25(16-23)28(32-34(26)4)29(38)30-12-6-14-35/h8-9,15,17,19,23H,5-7,10-14,16,18H2,1-4H3,(H,30,38) |
| InChIKey | HLWARHVBUVOPNR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.68 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |